C19H25N5O3 — CID 42101548
N-[(4-morpholin-4-ylphenyl)methyl]-1-[[(2S)-oxolan-2-yl]methyl]triazole-4-carboxamide (PubChem CID 42101548) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[(4-morpholin-4-ylphenyl)methyl]-1-[[(2S)-oxolan-2-yl]methyl]triazole-4-carboxamide.
| Compound Name | N-[(4-morpholin-4-ylphenyl)methyl]-1-[[(2S)-oxolan-2-yl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 42101548 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | N-[(4-morpholin-4-ylphenyl)methyl]-1-[[(2S)-oxolan-2-yl]methyl]triazole-4-carboxamide |
| SMILES | O=C(NCc1ccc(N2CCOCC2)cc1)c1cn(C[C@@H]2CCCO2)nn1 |
| InChI | InChI=1S/C19H25N5O3/c25-19(18-14-24(22-21-18)13-17-2-1-9-27-17)20-12-15-3-5-16(6-4-15)23-7-10-26-11-8-23/h3-6,14,17H,1-2,7-13H2,(H,20,25)/t17-/m0/s1 |
| InChIKey | IKDFKZHIHNAHDK-KRWDZBQOSA-N |
| XLogP | 1.22 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|