C8H11N3OS2 — CID 42104099
(3S)-3-(1,3,4-thiadiazol-2-ylsulfanyl)azepan-2-one (PubChem CID 42104099) has the molecular formula C8H11N3OS2 and a molecular weight of 229.33 g/mol. Its IUPAC name is (3S)-3-(1,3,4-thiadiazol-2-ylsulfanyl)azepan-2-one.
| Compound Name | (3S)-3-(1,3,4-thiadiazol-2-ylsulfanyl)azepan-2-one |
|---|---|
| PubChem CID | 42104099 |
| Molecular Formula | C8H11N3OS2 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | (3S)-3-(1,3,4-thiadiazol-2-ylsulfanyl)azepan-2-one |
| SMILES | O=C1NCCCC[C@@H]1Sc1nncs1 |
| InChI | InChI=1S/C8H11N3OS2/c12-7-6(3-1-2-4-9-7)14-8-11-10-5-13-8/h5-6H,1-4H2,(H,9,12)/t6-/m0/s1 |
| InChIKey | WOHLAGIZCLXWTJ-LURJTMIESA-N |
| XLogP | 1.30 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |