C8H12N4OS — CID 43050818
3-(1H-1,2,4-triazol-5-ylsulfanyl)azepan-2-one (PubChem CID 43050818) has the molecular formula C8H12N4OS and a molecular weight of 212.28 g/mol. Its IUPAC name is 3-(1H-1,2,4-triazol-5-ylsulfanyl)azepan-2-one.
| Compound Name | 3-(1H-1,2,4-triazol-5-ylsulfanyl)azepan-2-one |
|---|---|
| PubChem CID | 43050818 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 3-(1H-1,2,4-triazol-5-ylsulfanyl)azepan-2-one |
| SMILES | O=C1NCCCCC1Sc1ncn[nH]1 |
| InChI | InChI=1S/C8H12N4OS/c13-7-6(3-1-2-4-9-7)14-8-10-5-11-12-8/h5-6H,1-4H2,(H,9,13)(H,10,11,12) |
| InChIKey | SVMDYDBKDNLVNO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |