C22H22FNO5S — CID 4210622
ethyl 6-(2-fluorophenyl)-4-[3-(methanesulfonamido)phenyl]-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 4210622) has the molecular formula C22H22FNO5S and a molecular weight of 431.49 g/mol. Its IUPAC name is ethyl 6-(2-fluorophenyl)-4-[3-(methanesulfonamido)phenyl]-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 6-(2-fluorophenyl)-4-[3-(methanesulfonamido)phenyl]-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 4210622 |
| Molecular Formula | C22H22FNO5S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | ethyl 6-(2-fluorophenyl)-4-[3-(methanesulfonamido)phenyl]-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C=C(c2cccc(NS(C)(=O)=O)c2)CC1c1ccccc1F |
| InChI | InChI=1S/C22H22FNO5S/c1-3-29-22(26)21-18(17-9-4-5-10-19(17)23)12-15(13-20(21)25)14-7-6-8-16(11-14)24-30(2,27)28/h4-11,13,18,21,24H,3,12H2,1-2H3 |
| InChIKey | VCPRVIHAABSKBX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|