C26H32FNO5S — CID 54076020
N-[3-[1-(2,4-dioxo-6,6-dipropyloxan-3-yl)propyl]phenyl]-4-fluorobenzenesulfonamide (PubChem CID 54076020) has the molecular formula C26H32FNO5S and a molecular weight of 489.61 g/mol. Its IUPAC name is N-[3-[1-(2,4-dioxo-6,6-dipropyloxan-3-yl)propyl]phenyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[3-[1-(2,4-dioxo-6,6-dipropyloxan-3-yl)propyl]phenyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 54076020 |
| Molecular Formula | C26H32FNO5S |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | N-[3-[1-(2,4-dioxo-6,6-dipropyloxan-3-yl)propyl]phenyl]-4-fluorobenzenesulfonamide |
| SMILES | CCCC1(CCC)CC(=O)C(C(CC)c2cccc(NS(=O)(=O)c3ccc(F)cc3)c2)C(=O)O1 |
| InChI | InChI=1S/C26H32FNO5S/c1-4-14-26(15-5-2)17-23(29)24(25(30)33-26)22(6-3)18-8-7-9-20(16-18)28-34(31,32)21-12-10-19(27)11-13-21/h7-13,16,22,24,28H,4-6,14-15,17H2,1-3H3 |
| InChIKey | MJSMRVVLFQUPQJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|