C27H34FNO3 — CID 54427293
3-[1-(3-aminophenyl)-2,2-dimethylpropyl]-6-[2-(4-fluorophenyl)ethyl]-6-propyloxane-2,4-dione (PubChem CID 54427293) has the molecular formula C27H34FNO3 and a molecular weight of 439.57 g/mol. Its IUPAC name is 3-[1-(3-aminophenyl)-2,2-dimethylpropyl]-6-[2-(4-fluorophenyl)ethyl]-6-propyloxane-2,4-dione.
| Compound Name | 3-[1-(3-aminophenyl)-2,2-dimethylpropyl]-6-[2-(4-fluorophenyl)ethyl]-6-propyloxane-2,4-dione |
|---|---|
| PubChem CID | 54427293 |
| Molecular Formula | C27H34FNO3 |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 3-[1-(3-aminophenyl)-2,2-dimethylpropyl]-6-[2-(4-fluorophenyl)ethyl]-6-propyloxane-2,4-dione |
| SMILES | CCCC1(CCc2ccc(F)cc2)CC(=O)C(C(c2cccc(N)c2)C(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C27H34FNO3/c1-5-14-27(15-13-18-9-11-20(28)12-10-18)17-22(30)23(25(31)32-27)24(26(2,3)4)19-7-6-8-21(29)16-19/h6-12,16,23-24H,5,13-15,17,29H2,1-4H3 |
| InChIKey | WEZXWFOGRHGRGP-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|