C33H38FNO5S — CID 54434755
N-[3-[1-[2,4-dioxo-6-(2-phenylethyl)-6-propyloxan-3-yl]-2,2-dimethylpropyl]phenyl]-4-fluorobenzenesulfonamide (PubChem CID 54434755) has the molecular formula C33H38FNO5S and a molecular weight of 579.73 g/mol. Its IUPAC name is N-[3-[1-[2,4-dioxo-6-(2-phenylethyl)-6-propyloxan-3-yl]-2,2-dimethylpropyl]phenyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[3-[1-[2,4-dioxo-6-(2-phenylethyl)-6-propyloxan-3-yl]-2,2-dimethylpropyl]phenyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 54434755 |
| Molecular Formula | C33H38FNO5S |
| Molecular Weight | 579.73 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | N-[3-[1-[2,4-dioxo-6-(2-phenylethyl)-6-propyloxan-3-yl]-2,2-dimethylpropyl]phenyl]-4-fluorobenzenesulfonamide |
| SMILES | CCCC1(CCc2ccccc2)CC(=O)C(C(c2cccc(NS(=O)(=O)c3ccc(F)cc3)c2)C(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C33H38FNO5S/c1-5-19-33(20-18-23-10-7-6-8-11-23)22-28(36)29(31(37)40-33)30(32(2,3)4)24-12-9-13-26(21-24)35-41(38,39)27-16-14-25(34)15-17-27/h6-17,21,29-30,35H,5,18-20,22H2,1-4H3 |
| InChIKey | WJYMESCGDFWBNJ-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.73 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|