C32H35F2NO3 — CID 91314340
3-[1-(3-aminophenyl)-2,2-dimethylpropyl]-6,6-bis[2-(4-fluorophenyl)ethyl]oxane-2,4-dione (PubChem CID 91314340) has the molecular formula C32H35F2NO3 and a molecular weight of 519.63 g/mol. Its IUPAC name is 3-[1-(3-aminophenyl)-2,2-dimethylpropyl]-6,6-bis[2-(4-fluorophenyl)ethyl]oxane-2,4-dione.
| Compound Name | 3-[1-(3-aminophenyl)-2,2-dimethylpropyl]-6,6-bis[2-(4-fluorophenyl)ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91314340 |
| Molecular Formula | C32H35F2NO3 |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 3-[1-(3-aminophenyl)-2,2-dimethylpropyl]-6,6-bis[2-(4-fluorophenyl)ethyl]oxane-2,4-dione |
| SMILES | CC(C)(C)C(c1cccc(N)c1)C1C(=O)CC(CCc2ccc(F)cc2)(CCc2ccc(F)cc2)OC1=O |
| InChI | InChI=1S/C32H35F2NO3/c1-31(2,3)29(23-5-4-6-26(35)19-23)28-27(36)20-32(38-30(28)37,17-15-21-7-11-24(33)12-8-21)18-16-22-9-13-25(34)14-10-22/h4-14,19,28-29H,15-18,20,35H2,1-3H3 |
| InChIKey | ARDUQDLDDARHIM-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|