C32H34FNO5S — CID 54252868
N-[3-[[1-[2,4-dioxo-6-(2-phenylethyl)-6-propyloxan-3-yl]cyclopropyl]methyl]phenyl]-4-fluorobenzenesulfonamide (PubChem CID 54252868) has the molecular formula C32H34FNO5S and a molecular weight of 563.69 g/mol. Its IUPAC name is N-[3-[[1-[2,4-dioxo-6-(2-phenylethyl)-6-propyloxan-3-yl]cyclopropyl]methyl]phenyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[3-[[1-[2,4-dioxo-6-(2-phenylethyl)-6-propyloxan-3-yl]cyclopropyl]methyl]phenyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 54252868 |
| Molecular Formula | C32H34FNO5S |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | N-[3-[[1-[2,4-dioxo-6-(2-phenylethyl)-6-propyloxan-3-yl]cyclopropyl]methyl]phenyl]-4-fluorobenzenesulfonamide |
| SMILES | CCCC1(CCc2ccccc2)CC(=O)C(C2(Cc3cccc(NS(=O)(=O)c4ccc(F)cc4)c3)CC2)C(=O)O1 |
| InChI | InChI=1S/C32H34FNO5S/c1-2-16-32(17-15-23-7-4-3-5-8-23)22-28(35)29(30(36)39-32)31(18-19-31)21-24-9-6-10-26(20-24)34-40(37,38)27-13-11-25(33)12-14-27/h3-14,20,29,34H,2,15-19,21-22H2,1H3 |
| InChIKey | QXZNINWVRAZRKX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|