C25H27N3O4 — CID 4212870
methyl 2-[[2-[1-(1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]acetyl]amino]-4-methylpentanoate (PubChem CID 4212870) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is methyl 2-[[2-[1-(1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]acetyl]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[[2-[1-(1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]acetyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 4212870 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | methyl 2-[[2-[1-(1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]acetyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)CN1C(=O)c2ccccc2C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H27N3O4/c1-15(2)12-21(25(31)32-3)27-22(29)14-28-23(17-9-4-5-10-18(17)24(28)30)19-13-26-20-11-7-6-8-16(19)20/h4-11,13,15,21,23,26H,12,14H2,1-3H3,(H,27,29) |
| InChIKey | ROFXCYKJTWSLRM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |