C26H31N3O2 — CID 7343333
N-[(2R)-2-ethylhexyl]-2-[(1R)-1-(1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]acetamide (PubChem CID 7343333) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is N-[(2R)-2-ethylhexyl]-2-[(1R)-1-(1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]acetamide.
| Compound Name | N-[(2R)-2-ethylhexyl]-2-[(1R)-1-(1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]acetamide |
|---|---|
| PubChem CID | 7343333 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | N-[(2R)-2-ethylhexyl]-2-[(1R)-1-(1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]acetamide |
| SMILES | CCCC[C@@H](CC)CNC(=O)CN1C(=O)c2ccccc2[C@@H]1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C26H31N3O2/c1-3-5-10-18(4-2)15-28-24(30)17-29-25(20-12-6-7-13-21(20)26(29)31)22-16-27-23-14-9-8-11-19(22)23/h6-9,11-14,16,18,25,27H,3-5,10,15,17H2,1-2H3,(H,28,30)/t18-,25-/m1/s1 |
| InChIKey | VMRWVBSYVSRYBQ-IQGLISFBSA-N |
| XLogP | 5.05 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |