C21H21N3O3 — CID 7336774
2-[(1R)-1-(1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 7336774) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-[(1R)-1-(1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(1R)-1-(1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 7336774 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 2-[(1R)-1-(1H-indol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN1C(=O)c2ccccc2[C@@H]1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C21H21N3O3/c1-27-11-10-22-19(25)13-24-20(15-7-2-3-8-16(15)21(24)26)17-12-23-18-9-5-4-6-14(17)18/h2-9,12,20,23H,10-11,13H2,1H3,(H,22,25)/t20-/m1/s1 |
| InChIKey | ZKACMKNEPKGWTM-HXUWFJFHSA-N |
| XLogP | 2.48 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|