C27H39O8- — CID 4215528
6-[(17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 4215528) has the molecular formula C27H39O8- and a molecular weight of 491.60 g/mol. Its IUPAC name is 6-[(17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | 6-[(17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 4215528 |
| Molecular Formula | C27H39O8- |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 6-[(17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | CC(=O)C1CCC2C3CC=C4CC(OC5OC(C(=O)[O-])C(O)C(O)C5O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C27H40O8/c1-13(28)17-6-7-18-16-5-4-14-12-15(8-10-26(14,2)19(16)9-11-27(17,18)3)34-25-22(31)20(29)21(30)23(35-25)24(32)33/h4,15-23,25,29-31H,5-12H2,1-3H3,(H,32,33)/p-1 |
| InChIKey | OIXRDYLASYTIRO-UHFFFAOYSA-M |
| XLogP | 1.10 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|