C25H28N4O5S — CID 42157197
(2R)-4-[2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 42157197) has the molecular formula C25H28N4O5S and a molecular weight of 496.59 g/mol. Its IUPAC name is (2R)-4-[2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2R)-4-[2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 42157197 |
| Molecular Formula | C25H28N4O5S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | (2R)-4-[2-[4-oxo-3-(3-propan-2-yloxypropyl)quinazolin-2-yl]sulfanylacetyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CC(C)OCCCn1c(SCC(=O)N2C[C@H](C(N)=O)Oc3ccccc32)nc2ccccc2c1=O |
| InChI | InChI=1S/C25H28N4O5S/c1-16(2)33-13-7-12-28-24(32)17-8-3-4-9-18(17)27-25(28)35-15-22(30)29-14-21(23(26)31)34-20-11-6-5-10-19(20)29/h3-6,8-11,16,21H,7,12-15H2,1-2H3,(H2,26,31)/t21-/m1/s1 |
| InChIKey | WGCRKMLHMNPWRG-OAQYLSRUSA-N |
| XLogP | 2.58 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|