C27H24N4O4 — CID 42165935
N-[3-[5-methyl-4-[[(2-oxo-2-phenylacetyl)amino]methyl]-1,3-oxazol-2-yl]phenyl]-3-pyridin-3-ylpropanamide (PubChem CID 42165935) has the molecular formula C27H24N4O4 and a molecular weight of 468.51 g/mol. Its IUPAC name is N-[3-[5-methyl-4-[[(2-oxo-2-phenylacetyl)amino]methyl]-1,3-oxazol-2-yl]phenyl]-3-pyridin-3-ylpropanamide.
| Compound Name | N-[3-[5-methyl-4-[[(2-oxo-2-phenylacetyl)amino]methyl]-1,3-oxazol-2-yl]phenyl]-3-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 42165935 |
| Molecular Formula | C27H24N4O4 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | N-[3-[5-methyl-4-[[(2-oxo-2-phenylacetyl)amino]methyl]-1,3-oxazol-2-yl]phenyl]-3-pyridin-3-ylpropanamide |
| SMILES | Cc1oc(-c2cccc(NC(=O)CCc3cccnc3)c2)nc1CNC(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H24N4O4/c1-18-23(17-29-26(34)25(33)20-8-3-2-4-9-20)31-27(35-18)21-10-5-11-22(15-21)30-24(32)13-12-19-7-6-14-28-16-19/h2-11,14-16H,12-13,17H2,1H3,(H,29,34)(H,30,32) |
| InChIKey | QMNSYIAFTCGFLE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|