C26H28N4O3 — CID 45176298
N-[[5-methyl-2-[3-(3-pyridin-3-ylpropanoylamino)phenyl]-1,3-oxazol-4-yl]methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 45176298) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[[5-methyl-2-[3-(3-pyridin-3-ylpropanoylamino)phenyl]-1,3-oxazol-4-yl]methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[[5-methyl-2-[3-(3-pyridin-3-ylpropanoylamino)phenyl]-1,3-oxazol-4-yl]methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 45176298 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-[[5-methyl-2-[3-(3-pyridin-3-ylpropanoylamino)phenyl]-1,3-oxazol-4-yl]methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | Cc1oc(-c2cccc(NC(=O)CCc3cccnc3)c2)nc1CNC(=O)C1CC=CCC1 |
| InChI | InChI=1S/C26H28N4O3/c1-18-23(17-28-25(32)20-8-3-2-4-9-20)30-26(33-18)21-10-5-11-22(15-21)29-24(31)13-12-19-7-6-14-27-16-19/h2-3,5-7,10-11,14-16,20H,4,8-9,12-13,17H2,1H3,(H,28,32)(H,29,31) |
| InChIKey | JNEHBDXLRRZUKG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|