C28H34N4O4 — CID 42170194
2-[(3R)-1-(3-methoxypropyl)-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[(1R)-1-(6-methyl-1H-benzimidazol-2-yl)propyl]acetamide (PubChem CID 42170194) has the molecular formula C28H34N4O4 and a molecular weight of 490.60 g/mol. Its IUPAC name is 2-[(3R)-1-(3-methoxypropyl)-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[(1R)-1-(6-methyl-1H-benzimidazol-2-yl)propyl]acetamide.
| Compound Name | 2-[(3R)-1-(3-methoxypropyl)-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[(1R)-1-(6-methyl-1H-benzimidazol-2-yl)propyl]acetamide |
|---|---|
| PubChem CID | 42170194 |
| Molecular Formula | C28H34N4O4 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 2-[(3R)-1-(3-methoxypropyl)-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[(1R)-1-(6-methyl-1H-benzimidazol-2-yl)propyl]acetamide |
| SMILES | CC[C@@H](NC(=O)C[C@]1(c2ccccc2C)CC(=O)N(CCCOC)C1=O)c1nc2ccc(C)cc2[nH]1 |
| InChI | InChI=1S/C28H34N4O4/c1-5-21(26-30-22-12-11-18(2)15-23(22)31-26)29-24(33)16-28(20-10-7-6-9-19(20)3)17-25(34)32(27(28)35)13-8-14-36-4/h6-7,9-12,15,21H,5,8,13-14,16-17H2,1-4H3,(H,29,33)(H,30,31)/t21-,28-/m1/s1 |
| InChIKey | JJHIFVUJOHJVNI-LYZGTLIUSA-N |
| XLogP | 3.87 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|