C25H31N3O5 — CID 42168387
2-[(3S)-1-(3-methoxypropyl)-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[(2R)-2-pyridin-3-yloxypropyl]acetamide (PubChem CID 42168387) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is 2-[(3S)-1-(3-methoxypropyl)-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[(2R)-2-pyridin-3-yloxypropyl]acetamide.
| Compound Name | 2-[(3S)-1-(3-methoxypropyl)-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[(2R)-2-pyridin-3-yloxypropyl]acetamide |
|---|---|
| PubChem CID | 42168387 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 2-[(3S)-1-(3-methoxypropyl)-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]-N-[(2R)-2-pyridin-3-yloxypropyl]acetamide |
| SMILES | COCCCN1C(=O)C[C@@](CC(=O)NC[C@@H](C)Oc2cccnc2)(c2ccccc2C)C1=O |
| InChI | InChI=1S/C25H31N3O5/c1-18-8-4-5-10-21(18)25(15-23(30)28(24(25)31)12-7-13-32-3)14-22(29)27-16-19(2)33-20-9-6-11-26-17-20/h4-6,8-11,17,19H,7,12-16H2,1-3H3,(H,27,29)/t19-,25+/m1/s1 |
| InChIKey | GPAKBDAEIYJOEJ-CLOONOSVSA-N |
| XLogP | 2.40 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|