C26H30N4O4 — CID 26352132
N-(3-indazol-1-ylpropyl)-2-[(3R)-1-(2-methoxyethyl)-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]acetamide (PubChem CID 26352132) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-(3-indazol-1-ylpropyl)-2-[(3R)-1-(2-methoxyethyl)-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]acetamide.
| Compound Name | N-(3-indazol-1-ylpropyl)-2-[(3R)-1-(2-methoxyethyl)-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 26352132 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | N-(3-indazol-1-ylpropyl)-2-[(3R)-1-(2-methoxyethyl)-3-(2-methylphenyl)-2,5-dioxopyrrolidin-3-yl]acetamide |
| SMILES | COCCN1C(=O)C[C@](CC(=O)NCCCn2ncc3ccccc32)(c2ccccc2C)C1=O |
| InChI | InChI=1S/C26H30N4O4/c1-19-8-3-5-10-21(19)26(17-24(32)29(25(26)33)14-15-34-2)16-23(31)27-12-7-13-30-22-11-6-4-9-20(22)18-28-30/h3-6,8-11,18H,7,12-17H2,1-2H3,(H,27,31)/t26-/m1/s1 |
| InChIKey | FOFOMOMTIIMDIX-AREMUKBSSA-N |
| XLogP | 2.58 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|