C25H29N5O4 — CID 42454984
N-[3-(benzotriazol-1-yl)propyl]-2-[(3S)-1-(3-methoxypropyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]acetamide (PubChem CID 42454984) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is N-[3-(benzotriazol-1-yl)propyl]-2-[(3S)-1-(3-methoxypropyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]acetamide.
| Compound Name | N-[3-(benzotriazol-1-yl)propyl]-2-[(3S)-1-(3-methoxypropyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 42454984 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | N-[3-(benzotriazol-1-yl)propyl]-2-[(3S)-1-(3-methoxypropyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]acetamide |
| SMILES | COCCCN1C(=O)C[C@@](CC(=O)NCCCn2nnc3ccccc32)(c2ccccc2)C1=O |
| InChI | InChI=1S/C25H29N5O4/c1-34-16-8-14-29-23(32)18-25(24(29)33,19-9-3-2-4-10-19)17-22(31)26-13-7-15-30-21-12-6-5-11-20(21)27-28-30/h2-6,9-12H,7-8,13-18H2,1H3,(H,26,31)/t25-/m0/s1 |
| InChIKey | MFPJNLAKUFEOOZ-VWLOTQADSA-N |
| XLogP | 2.06 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|