C26H30N4O4 — CID 45175369
2-[1-(3-methoxypropyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]-N-[1-(6-methyl-1H-benzimidazol-2-yl)ethyl]acetamide (PubChem CID 45175369) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-[1-(3-methoxypropyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]-N-[1-(6-methyl-1H-benzimidazol-2-yl)ethyl]acetamide.
| Compound Name | 2-[1-(3-methoxypropyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]-N-[1-(6-methyl-1H-benzimidazol-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 45175369 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 2-[1-(3-methoxypropyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]-N-[1-(6-methyl-1H-benzimidazol-2-yl)ethyl]acetamide |
| SMILES | COCCCN1C(=O)CC(CC(=O)NC(C)c2nc3ccc(C)cc3[nH]2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C26H30N4O4/c1-17-10-11-20-21(14-17)29-24(28-20)18(2)27-22(31)15-26(19-8-5-4-6-9-19)16-23(32)30(25(26)33)12-7-13-34-3/h4-6,8-11,14,18H,7,12-13,15-16H2,1-3H3,(H,27,31)(H,28,29) |
| InChIKey | ITBRMMRYDRJMHA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|