C22H31N3O5 — CID 45169809
(2S)-2-[[2-[1-(3-methoxypropyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]acetyl]amino]-4-methylpentanamide (PubChem CID 45169809) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is (2S)-2-[[2-[1-(3-methoxypropyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]acetyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-2-[[2-[1-(3-methoxypropyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]acetyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 45169809 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (2S)-2-[[2-[1-(3-methoxypropyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]acetyl]amino]-4-methylpentanamide |
| SMILES | COCCCN1C(=O)CC(CC(=O)N[C@@H](CC(C)C)C(N)=O)(c2ccccc2)C1=O |
| InChI | InChI=1S/C22H31N3O5/c1-15(2)12-17(20(23)28)24-18(26)13-22(16-8-5-4-6-9-16)14-19(27)25(21(22)29)10-7-11-30-3/h4-6,8-9,15,17H,7,10-14H2,1-3H3,(H2,23,28)(H,24,26)/t17-,22?/m0/s1 |
| InChIKey | KYUBKFFLEDEWBP-LBOXEOMUSA-N |
| XLogP | 1.13 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|