C28H33N3O5 — CID 42274081
(3R)-3-[2-[4-(4-acetylphenyl)piperazin-1-yl]-2-oxoethyl]-1-(3-methoxypropyl)-3-phenylpyrrolidine-2,5-dione (PubChem CID 42274081) has the molecular formula C28H33N3O5 and a molecular weight of 491.59 g/mol. Its IUPAC name is (3R)-3-[2-[4-(4-acetylphenyl)piperazin-1-yl]-2-oxoethyl]-1-(3-methoxypropyl)-3-phenylpyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[2-[4-(4-acetylphenyl)piperazin-1-yl]-2-oxoethyl]-1-(3-methoxypropyl)-3-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42274081 |
| Molecular Formula | C28H33N3O5 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | (3R)-3-[2-[4-(4-acetylphenyl)piperazin-1-yl]-2-oxoethyl]-1-(3-methoxypropyl)-3-phenylpyrrolidine-2,5-dione |
| SMILES | COCCCN1C(=O)C[C@](CC(=O)N2CCN(c3ccc(C(C)=O)cc3)CC2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C28H33N3O5/c1-21(32)22-9-11-24(12-10-22)29-14-16-30(17-15-29)25(33)19-28(23-7-4-3-5-8-23)20-26(34)31(27(28)35)13-6-18-36-2/h3-5,7-12H,6,13-20H2,1-2H3/t28-/m1/s1 |
| InChIKey | JJYPYQIOBVBHEH-MUUNZHRXSA-N |
| XLogP | 2.66 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|