C29H30N4O3 — CID 42379886
(3S)-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3-phenyl-1-(2-pyridin-2-ylethyl)pyrrolidine-2,5-dione (PubChem CID 42379886) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is (3S)-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3-phenyl-1-(2-pyridin-2-ylethyl)pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3-phenyl-1-(2-pyridin-2-ylethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42379886 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | (3S)-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3-phenyl-1-(2-pyridin-2-ylethyl)pyrrolidine-2,5-dione |
| SMILES | O=C(C[C@@]1(c2ccccc2)CC(=O)N(CCc2ccccn2)C1=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C29H30N4O3/c34-26(32-19-17-31(18-20-32)25-12-5-2-6-13-25)21-29(23-9-3-1-4-10-23)22-27(35)33(28(29)36)16-14-24-11-7-8-15-30-24/h1-13,15H,14,16-22H2/t29-/m0/s1 |
| InChIKey | NMPLEISVECCOKN-LJAQVGFWSA-N |
| XLogP | 3.06 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|