C28H29N3O4 — CID 45196517
2-[2,5-dioxo-3-phenyl-1-(2-pyridin-2-ylethyl)pyrrolidin-3-yl]-N-(2-hydroxy-2-phenylethyl)-N-methylacetamide (PubChem CID 45196517) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is 2-[2,5-dioxo-3-phenyl-1-(2-pyridin-2-ylethyl)pyrrolidin-3-yl]-N-(2-hydroxy-2-phenylethyl)-N-methylacetamide.
| Compound Name | 2-[2,5-dioxo-3-phenyl-1-(2-pyridin-2-ylethyl)pyrrolidin-3-yl]-N-(2-hydroxy-2-phenylethyl)-N-methylacetamide |
|---|---|
| PubChem CID | 45196517 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 2-[2,5-dioxo-3-phenyl-1-(2-pyridin-2-ylethyl)pyrrolidin-3-yl]-N-(2-hydroxy-2-phenylethyl)-N-methylacetamide |
| SMILES | CN(CC(O)c1ccccc1)C(=O)CC1(c2ccccc2)CC(=O)N(CCc2ccccn2)C1=O |
| InChI | InChI=1S/C28H29N3O4/c1-30(20-24(32)21-10-4-2-5-11-21)25(33)18-28(22-12-6-3-7-13-22)19-26(34)31(27(28)35)17-15-23-14-8-9-16-29-23/h2-14,16,24,32H,15,17-20H2,1H3 |
| InChIKey | HHGMZFZIYLVUOQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|