C28H34N2O4 — CID 42455663
2-[(3R)-1-(cyclohexylmethyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]-N-[(2S)-2-hydroxy-2-phenylethyl]-N-methylacetamide (PubChem CID 42455663) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is 2-[(3R)-1-(cyclohexylmethyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]-N-[(2S)-2-hydroxy-2-phenylethyl]-N-methylacetamide.
| Compound Name | 2-[(3R)-1-(cyclohexylmethyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]-N-[(2S)-2-hydroxy-2-phenylethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 42455663 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 2-[(3R)-1-(cyclohexylmethyl)-2,5-dioxo-3-phenylpyrrolidin-3-yl]-N-[(2S)-2-hydroxy-2-phenylethyl]-N-methylacetamide |
| SMILES | CN(C[C@@H](O)c1ccccc1)C(=O)C[C@]1(c2ccccc2)CC(=O)N(CC2CCCCC2)C1=O |
| InChI | InChI=1S/C28H34N2O4/c1-29(20-24(31)22-13-7-3-8-14-22)25(32)17-28(23-15-9-4-10-16-23)18-26(33)30(27(28)34)19-21-11-5-2-6-12-21/h3-4,7-10,13-16,21,24,31H,2,5-6,11-12,17-20H2,1H3/t24-,28-/m1/s1 |
| InChIKey | CGFXDXUNHKYAPN-UFHPHHKVSA-N |
| XLogP | 3.85 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|