C19H30N2O2 — CID 4217997
N-[2-(cyclohexen-1-yl)ethyl]-1-cyclohexyl-5-oxopyrrolidine-2-carboxamide (PubChem CID 4217997) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1-cyclohexyl-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1-cyclohexyl-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 4217997 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1-cyclohexyl-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)C1CCC(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C19H30N2O2/c22-18-12-11-17(21(18)16-9-5-2-6-10-16)19(23)20-14-13-15-7-3-1-4-8-15/h7,16-17H,1-6,8-14H2,(H,20,23) |
| InChIKey | RPLJQMMYJFOGLU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|