C20H20BrN5O2S — CID 4218595
4-bromo-1,5-dimethyl-N-[1-[4-[(5-methylthiophene-2-carbonyl)amino]phenyl]ethylideneamino]pyrazole-3-carboxamide (PubChem CID 4218595) has the molecular formula C20H20BrN5O2S and a molecular weight of 474.38 g/mol. Its IUPAC name is 4-bromo-1,5-dimethyl-N-[1-[4-[(5-methylthiophene-2-carbonyl)amino]phenyl]ethylideneamino]pyrazole-3-carboxamide.
| Compound Name | 4-bromo-1,5-dimethyl-N-[1-[4-[(5-methylthiophene-2-carbonyl)amino]phenyl]ethylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4218595 |
| Molecular Formula | C20H20BrN5O2S |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 473.05 |
| IUPAC Name | 4-bromo-1,5-dimethyl-N-[1-[4-[(5-methylthiophene-2-carbonyl)amino]phenyl]ethylideneamino]pyrazole-3-carboxamide |
| SMILES | CC(=NNC(=O)c1nn(C)c(C)c1Br)c1ccc(NC(=O)c2ccc(C)s2)cc1 |
| InChI | InChI=1S/C20H20BrN5O2S/c1-11-5-10-16(29-11)19(27)22-15-8-6-14(7-9-15)12(2)23-24-20(28)18-17(21)13(3)26(4)25-18/h5-10H,1-4H3,(H,22,27)(H,24,28) |
| InChIKey | XFECPRAVYQFQHI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|