C18H27N5O — CID 42191280
N,2,2,6,6-pentamethyl-N-[(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidin-4-amine (PubChem CID 42191280) has the molecular formula C18H27N5O and a molecular weight of 329.45 g/mol. Its IUPAC name is N,2,2,6,6-pentamethyl-N-[(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidin-4-amine.
| Compound Name | N,2,2,6,6-pentamethyl-N-[(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 42191280 |
| Molecular Formula | C18H27N5O |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | N,2,2,6,6-pentamethyl-N-[(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)methyl]piperidin-4-amine |
| SMILES | CN(Cc1nc(-c2ccccn2)no1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C18H27N5O/c1-17(2)10-13(11-18(3,4)22-17)23(5)12-15-20-16(21-24-15)14-8-6-7-9-19-14/h6-9,13,22H,10-12H2,1-5H3 |
| InChIKey | QYNFYQIHOXLIKK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |