C20H28N2O2 — CID 42196111
(3R,4R)-4-(azepan-1-yl)-1-(1-benzofuran-2-ylmethyl)piperidin-3-ol (PubChem CID 42196111) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (3R,4R)-4-(azepan-1-yl)-1-(1-benzofuran-2-ylmethyl)piperidin-3-ol.
| Compound Name | (3R,4R)-4-(azepan-1-yl)-1-(1-benzofuran-2-ylmethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 42196111 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (3R,4R)-4-(azepan-1-yl)-1-(1-benzofuran-2-ylmethyl)piperidin-3-ol |
| SMILES | O[C@@H]1CN(Cc2cc3ccccc3o2)CC[C@H]1N1CCCCCC1 |
| InChI | InChI=1S/C20H28N2O2/c23-19-15-21(12-9-18(19)22-10-5-1-2-6-11-22)14-17-13-16-7-3-4-8-20(16)24-17/h3-4,7-8,13,18-19,23H,1-2,5-6,9-12,14-15H2/t18-,19-/m1/s1 |
| InChIKey | XWIHUPSOWGKECQ-RTBURBONSA-N |
| XLogP | 3.24 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |