C20H20N6O — CID 42197037
N-[(1R)-1-(1H-benzimidazol-2-yl)ethyl]-1-[(2-methylphenyl)methyl]triazole-4-carboxamide (PubChem CID 42197037) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is N-[(1R)-1-(1H-benzimidazol-2-yl)ethyl]-1-[(2-methylphenyl)methyl]triazole-4-carboxamide.
| Compound Name | N-[(1R)-1-(1H-benzimidazol-2-yl)ethyl]-1-[(2-methylphenyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 42197037 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | N-[(1R)-1-(1H-benzimidazol-2-yl)ethyl]-1-[(2-methylphenyl)methyl]triazole-4-carboxamide |
| SMILES | Cc1ccccc1Cn1cc(C(=O)N[C@H](C)c2nc3ccccc3[nH]2)nn1 |
| InChI | InChI=1S/C20H20N6O/c1-13-7-3-4-8-15(13)11-26-12-18(24-25-26)20(27)21-14(2)19-22-16-9-5-6-10-17(16)23-19/h3-10,12,14H,11H2,1-2H3,(H,21,27)(H,22,23)/t14-/m1/s1 |
| InChIKey | KCOOHELMPOLYLN-CQSZACIVSA-N |
| XLogP | 3.00 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |