C19H28N2O2 — CID 42199493
1-[(3S)-3-(3,4-dimethylanilino)piperidin-1-yl]-4-methylpentane-1,2-dione (PubChem CID 42199493) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 1-[(3S)-3-(3,4-dimethylanilino)piperidin-1-yl]-4-methylpentane-1,2-dione.
| Compound Name | 1-[(3S)-3-(3,4-dimethylanilino)piperidin-1-yl]-4-methylpentane-1,2-dione |
|---|---|
| PubChem CID | 42199493 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 1-[(3S)-3-(3,4-dimethylanilino)piperidin-1-yl]-4-methylpentane-1,2-dione |
| SMILES | Cc1ccc(N[C@H]2CCCN(C(=O)C(=O)CC(C)C)C2)cc1C |
| InChI | InChI=1S/C19H28N2O2/c1-13(2)10-18(22)19(23)21-9-5-6-17(12-21)20-16-8-7-14(3)15(4)11-16/h7-8,11,13,17,20H,5-6,9-10,12H2,1-4H3/t17-/m0/s1 |
| InChIKey | VECNJSFURDRKOL-KRWDZBQOSA-N |
| XLogP | 3.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|