C23H24N2O3 — CID 45240420
2-[3-(3,4-dimethylanilino)piperidine-1-carbonyl]chromen-4-one (PubChem CID 45240420) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-[3-(3,4-dimethylanilino)piperidine-1-carbonyl]chromen-4-one.
| Compound Name | 2-[3-(3,4-dimethylanilino)piperidine-1-carbonyl]chromen-4-one |
|---|---|
| PubChem CID | 45240420 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-[3-(3,4-dimethylanilino)piperidine-1-carbonyl]chromen-4-one |
| SMILES | Cc1ccc(NC2CCCN(C(=O)c3cc(=O)c4ccccc4o3)C2)cc1C |
| InChI | InChI=1S/C23H24N2O3/c1-15-9-10-17(12-16(15)2)24-18-6-5-11-25(14-18)23(27)22-13-20(26)19-7-3-4-8-21(19)28-22/h3-4,7-10,12-13,18,24H,5-6,11,14H2,1-2H3 |
| InChIKey | PPHOXHMADDWBII-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |