C26H21Cl3FN3O — CID 4220074
5-chloro-7-[(2,4-dichlorophenyl)-[4-(4-fluorophenyl)piperazin-1-yl]methyl]quinolin-8-ol (PubChem CID 4220074) has the molecular formula C26H21Cl3FN3O and a molecular weight of 516.83 g/mol. Its IUPAC name is 5-chloro-7-[(2,4-dichlorophenyl)-[4-(4-fluorophenyl)piperazin-1-yl]methyl]quinolin-8-ol.
| Compound Name | 5-chloro-7-[(2,4-dichlorophenyl)-[4-(4-fluorophenyl)piperazin-1-yl]methyl]quinolin-8-ol |
|---|---|
| PubChem CID | 4220074 |
| Molecular Formula | C26H21Cl3FN3O |
| Molecular Weight | 516.83 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | 5-chloro-7-[(2,4-dichlorophenyl)-[4-(4-fluorophenyl)piperazin-1-yl]methyl]quinolin-8-ol |
| SMILES | Oc1c(C(c2ccc(Cl)cc2Cl)N2CCN(c3ccc(F)cc3)CC2)cc(Cl)c2cccnc12 |
| InChI | InChI=1S/C26H21Cl3FN3O/c27-16-3-8-20(22(28)14-16)25(21-15-23(29)19-2-1-9-31-24(19)26(21)34)33-12-10-32(11-13-33)18-6-4-17(30)5-7-18/h1-9,14-15,25,34H,10-13H2 |
| InChIKey | JVWTZGXMKBGVSH-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.83 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|