C22H22ClN3O6S — CID 4220523
4-[[2-[2-(4-chloro-2,5-dimethoxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid (PubChem CID 4220523) has the molecular formula C22H22ClN3O6S and a molecular weight of 491.95 g/mol. Its IUPAC name is 4-[[2-[2-(4-chloro-2,5-dimethoxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[2-(4-chloro-2,5-dimethoxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 4220523 |
| Molecular Formula | C22H22ClN3O6S |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | 4-[[2-[2-(4-chloro-2,5-dimethoxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]acetyl]amino]benzoic acid |
| SMILES | CCN1C(=O)C(CC(=O)Nc2ccc(C(=O)O)cc2)S/C1=N\c1cc(OC)c(Cl)cc1OC |
| InChI | InChI=1S/C22H22ClN3O6S/c1-4-26-20(28)18(11-19(27)24-13-7-5-12(6-8-13)21(29)30)33-22(26)25-15-10-16(31-2)14(23)9-17(15)32-3/h5-10,18H,4,11H2,1-3H3,(H,24,27)(H,29,30)/b25-22- |
| InChIKey | ODIYZGKYUIILJP-LVWGJNHUSA-N |
| XLogP | 4.04 |
| TPSA | 117.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|