C14H15ClN2O4S — CID 45143212
2-[2-(5-chloro-2-methoxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 45143212) has the molecular formula C14H15ClN2O4S and a molecular weight of 342.80 g/mol. Its IUPAC name is 2-[2-(5-chloro-2-methoxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[2-(5-chloro-2-methoxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 45143212 |
| Molecular Formula | C14H15ClN2O4S |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2-[2-(5-chloro-2-methoxyphenyl)imino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | CCN1C(=O)C(CC(=O)O)S/C1=N/c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C14H15ClN2O4S/c1-3-17-13(20)11(7-12(18)19)22-14(17)16-9-6-8(15)4-5-10(9)21-2/h4-6,11H,3,7H2,1-2H3,(H,18,19)/b16-14+ |
| InChIKey | ONFZGMYIMNHAQA-JQIJEIRASA-N |
| XLogP | 2.77 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|