C43H53ClFNO6 — CID 4220886
N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-2-(3,4-dimethoxyphenyl)-N-propylacetamide (PubChem CID 4220886) has the molecular formula C43H53ClFNO6 and a molecular weight of 734.35 g/mol. Its IUPAC name is N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-2-(3,4-dimethoxyphenyl)-N-propylacetamide.
| Compound Name | N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-2-(3,4-dimethoxyphenyl)-N-propylacetamide |
|---|---|
| PubChem CID | 4220886 |
| Molecular Formula | C43H53ClFNO6 |
| Molecular Weight | 734.35 g/mol |
| Exact Mass | 733.35 |
| IUPAC Name | N-[[17-[2-(2-chloro-6-fluorophenyl)acetyl]-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-2-(3,4-dimethoxyphenyl)-N-propylacetamide |
| SMILES | CCCN(CC1(O)CCC2c3ccc(cc3C(=O)Cc3c(F)cccc3Cl)CC(O)CCC(C)=CCCC21C)C(=O)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C43H53ClFNO6/c1-6-21-46(41(49)25-30-14-17-39(51-4)40(24-30)52-5)27-43(50)20-18-35-32-16-13-29(22-31(47)15-12-28(2)9-8-19-42(35,43)3)23-33(32)38(48)26-34-36(44)10-7-11-37(34)45/h7,9-11,13-14,16-17,23-24,31,35,47,50H,6,8,12,15,18-22,25-27H2,1-5H3 |
| InChIKey | JTXXZRMMXOXTCI-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.35 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|