C28H35N3O2 — CID 42210163
(2R)-N-benzyl-6-[4-(piperidin-1-ylmethyl)benzoyl]-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 42210163) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is (2R)-N-benzyl-6-[4-(piperidin-1-ylmethyl)benzoyl]-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | (2R)-N-benzyl-6-[4-(piperidin-1-ylmethyl)benzoyl]-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 42210163 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | (2R)-N-benzyl-6-[4-(piperidin-1-ylmethyl)benzoyl]-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@@H]1CC12CCN(C(=O)c1ccc(CN3CCCCC3)cc1)CC2 |
| InChI | InChI=1S/C28H35N3O2/c32-26(29-20-22-7-3-1-4-8-22)25-19-28(25)13-17-31(18-14-28)27(33)24-11-9-23(10-12-24)21-30-15-5-2-6-16-30/h1,3-4,7-12,25H,2,5-6,13-21H2,(H,29,32)/t25-/m0/s1 |
| InChIKey | XXZHKXJIKPCKAY-VWLOTQADSA-N |
| XLogP | 4.23 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |