C22H23F3N2O — CID 126462966
N-benzyl-6-[(2,3,6-trifluorophenyl)methyl]-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 126462966) has the molecular formula C22H23F3N2O and a molecular weight of 388.43 g/mol. Its IUPAC name is N-benzyl-6-[(2,3,6-trifluorophenyl)methyl]-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | N-benzyl-6-[(2,3,6-trifluorophenyl)methyl]-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 126462966 |
| Molecular Formula | C22H23F3N2O |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | N-benzyl-6-[(2,3,6-trifluorophenyl)methyl]-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CC12CCN(Cc1c(F)ccc(F)c1F)CC2 |
| InChI | InChI=1S/C22H23F3N2O/c23-18-6-7-19(24)20(25)16(18)14-27-10-8-22(9-11-27)12-17(22)21(28)26-13-15-4-2-1-3-5-15/h1-7,17H,8-14H2,(H,26,28) |
| InChIKey | POFOXTKXJIMAHY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|