C22H18N6O2S2 — CID 4222989
10-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 4222989) has the molecular formula C22H18N6O2S2 and a molecular weight of 462.56 g/mol. Its IUPAC name is 10-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 10-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 4222989 |
| Molecular Formula | C22H18N6O2S2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 10-[(5-oxo-4-prop-2-enyl-[1,2,4]triazolo[4,3-a]quinazolin-1-yl)sulfanylmethyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | C=CCn1c(=O)c2ccccc2n2c(SCc3nc4sc5c(c4c(=O)[nH]3)CCC5)nnc12 |
| InChI | InChI=1S/C22H18N6O2S2/c1-2-10-27-20(30)12-6-3-4-8-14(12)28-21(27)25-26-22(28)31-11-16-23-18(29)17-13-7-5-9-15(13)32-19(17)24-16/h2-4,6,8H,1,5,7,9-11H2,(H,23,24,29) |
| InChIKey | DDBWLPHGNGEOOH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 97.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|