C25H20N4O2S3 — CID 2441878
10-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 2441878) has the molecular formula C25H20N4O2S3 and a molecular weight of 504.66 g/mol. Its IUPAC name is 10-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 10-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 2441878 |
| Molecular Formula | C25H20N4O2S3 |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | 10-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-11-prop-2-enyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | C=CCn1c(SCc2nc3scc(-c4ccccc4)c3c(=O)[nH]2)nc2sc3c(c2c1=O)CCC3 |
| InChI | InChI=1S/C25H20N4O2S3/c1-2-11-29-24(31)20-15-9-6-10-17(15)34-23(20)28-25(29)33-13-18-26-21(30)19-16(12-32-22(19)27-18)14-7-4-3-5-8-14/h2-5,7-8,12H,1,6,9-11,13H2,(H,26,27,30) |
| InChIKey | WWHXQEYHQYSDLX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|