C21H24ClN3O6S — CID 4223530
[2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 2-ethoxypyridine-3-carboxylate (PubChem CID 4223530) has the molecular formula C21H24ClN3O6S and a molecular weight of 481.96 g/mol. Its IUPAC name is [2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 2-ethoxypyridine-3-carboxylate.
| Compound Name | [2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 2-ethoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 4223530 |
| Molecular Formula | C21H24ClN3O6S |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | [2-(2-chloro-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 2-ethoxypyridine-3-carboxylate |
| SMILES | CCOc1ncccc1C(=O)OCC(=O)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C21H24ClN3O6S/c1-2-30-20-16(7-6-10-23-20)21(27)31-14-19(26)24-18-13-15(8-9-17(18)22)32(28,29)25-11-4-3-5-12-25/h6-10,13H,2-5,11-12,14H2,1H3,(H,24,26) |
| InChIKey | IYEVPOUECSIKAE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |