C19H19Cl2N3O6S — CID 3561878
[2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate (PubChem CID 3561878) has the molecular formula C19H19Cl2N3O6S and a molecular weight of 488.35 g/mol. Its IUPAC name is [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 3561878 |
| Molecular Formula | C19H19Cl2N3O6S |
| Molecular Weight | 488.35 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | [2-(2-methyl-5-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5,6-dichloropyridine-3-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)COC(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H19Cl2N3O6S/c1-12-2-3-14(31(27,28)24-4-6-29-7-5-24)9-16(12)23-17(25)11-30-19(26)13-8-15(20)18(21)22-10-13/h2-3,8-10H,4-7,11H2,1H3,(H,23,25) |
| InChIKey | CCSCLYDEGOVYIP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|