C20H22ClN3O5S — CID 5028955
[1-(2-chloro-5-piperidin-1-ylsulfonylanilino)-1-oxopropan-2-yl] pyridine-4-carboxylate (PubChem CID 5028955) has the molecular formula C20H22ClN3O5S and a molecular weight of 451.93 g/mol. Its IUPAC name is [1-(2-chloro-5-piperidin-1-ylsulfonylanilino)-1-oxopropan-2-yl] pyridine-4-carboxylate.
| Compound Name | [1-(2-chloro-5-piperidin-1-ylsulfonylanilino)-1-oxopropan-2-yl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 5028955 |
| Molecular Formula | C20H22ClN3O5S |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | [1-(2-chloro-5-piperidin-1-ylsulfonylanilino)-1-oxopropan-2-yl] pyridine-4-carboxylate |
| SMILES | CC(OC(=O)c1ccncc1)C(=O)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C20H22ClN3O5S/c1-14(29-20(26)15-7-9-22-10-8-15)19(25)23-18-13-16(5-6-17(18)21)30(27,28)24-11-3-2-4-12-24/h5-10,13-14H,2-4,11-12H2,1H3,(H,23,25) |
| InChIKey | OFLNZRXDEZZELU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |