C25H23ClN2O4 — CID 42246262
(E)-N-[[(2R)-5-chloro-7-pyridin-4-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide (PubChem CID 42246262) has the molecular formula C25H23ClN2O4 and a molecular weight of 450.92 g/mol. Its IUPAC name is (E)-N-[[(2R)-5-chloro-7-pyridin-4-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[[(2R)-5-chloro-7-pyridin-4-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 42246262 |
| Molecular Formula | C25H23ClN2O4 |
| Molecular Weight | 450.92 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | (E)-N-[[(2R)-5-chloro-7-pyridin-4-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-(3,4-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NC[C@H]2Cc3cc(Cl)cc(-c4ccncc4)c3O2)cc1OC |
| InChI | InChI=1S/C25H23ClN2O4/c1-30-22-5-3-16(11-23(22)31-2)4-6-24(29)28-15-20-13-18-12-19(26)14-21(25(18)32-20)17-7-9-27-10-8-17/h3-12,14,20H,13,15H2,1-2H3,(H,28,29)/b6-4+/t20-/m1/s1 |
| InChIKey | RUWAJRPZACAKLY-PEAOBZDDSA-N |
| XLogP | 4.55 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.92 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|