C22H17ClFN3O2 — CID 42246124
(E)-N-[[(2R)-5-chloro-7-pyrazin-2-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-(2-fluorophenyl)prop-2-enamide (PubChem CID 42246124) has the molecular formula C22H17ClFN3O2 and a molecular weight of 409.85 g/mol. Its IUPAC name is (E)-N-[[(2R)-5-chloro-7-pyrazin-2-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-(2-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[(2R)-5-chloro-7-pyrazin-2-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 42246124 |
| Molecular Formula | C22H17ClFN3O2 |
| Molecular Weight | 409.85 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | (E)-N-[[(2R)-5-chloro-7-pyrazin-2-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-(2-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1F)NC[C@H]1Cc2cc(Cl)cc(-c3cnccn3)c2O1 |
| InChI | InChI=1S/C22H17ClFN3O2/c23-16-9-15-10-17(29-22(15)18(11-16)20-13-25-7-8-26-20)12-27-21(28)6-5-14-3-1-2-4-19(14)24/h1-9,11,13,17H,10,12H2,(H,27,28)/b6-5+/t17-/m1/s1 |
| InChIKey | QBJFBKNPCYAAPW-FUTAKVPZSA-N |
| XLogP | 4.07 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.85 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|