C20H16FN3O2S — CID 42368240
(E)-N-[[(2S)-5-fluoro-7-pyrazin-2-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 42368240) has the molecular formula C20H16FN3O2S and a molecular weight of 381.43 g/mol. Its IUPAC name is (E)-N-[[(2S)-5-fluoro-7-pyrazin-2-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[[(2S)-5-fluoro-7-pyrazin-2-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 42368240 |
| Molecular Formula | C20H16FN3O2S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | (E)-N-[[(2S)-5-fluoro-7-pyrazin-2-yl-2,3-dihydro-1-benzofuran-2-yl]methyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)NC[C@@H]1Cc2cc(F)cc(-c3cnccn3)c2O1 |
| InChI | InChI=1S/C20H16FN3O2S/c21-14-8-13-9-15(11-24-19(25)4-3-16-2-1-7-27-16)26-20(13)17(10-14)18-12-22-5-6-23-18/h1-8,10,12,15H,9,11H2,(H,24,25)/b4-3+/t15-/m0/s1 |
| InChIKey | BKPAGCORGZJHAJ-BWPKMQGJSA-N |
| XLogP | 3.48 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|