C20H17N3O2S — CID 74496936
N-[(7-pyrazin-2-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 74496936) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-[(7-pyrazin-2-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[(7-pyrazin-2-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 74496936 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | N-[(7-pyrazin-2-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(C=Cc1cccs1)NCC1Cc2cccc(-c3cnccn3)c2O1 |
| InChI | InChI=1S/C20H17N3O2S/c24-19(7-6-16-4-2-10-26-16)23-12-15-11-14-3-1-5-17(20(14)25-15)18-13-21-8-9-22-18/h1-10,13,15H,11-12H2,(H,23,24) |
| InChIKey | BMJYDHOUNLFWKC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|