C23H19FN2O2 — CID 74780992
3-(3-fluorophenyl)-N-[(7-pyridin-4-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]prop-2-enamide (PubChem CID 74780992) has the molecular formula C23H19FN2O2 and a molecular weight of 374.42 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-N-[(7-pyridin-4-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]prop-2-enamide.
| Compound Name | 3-(3-fluorophenyl)-N-[(7-pyridin-4-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 74780992 |
| Molecular Formula | C23H19FN2O2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3-(3-fluorophenyl)-N-[(7-pyridin-4-yl-2,3-dihydro-1-benzofuran-2-yl)methyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cccc(F)c1)NCC1Cc2cccc(-c3ccncc3)c2O1 |
| InChI | InChI=1S/C23H19FN2O2/c24-19-5-1-3-16(13-19)7-8-22(27)26-15-20-14-18-4-2-6-21(23(18)28-20)17-9-11-25-12-10-17/h1-13,20H,14-15H2,(H,26,27) |
| InChIKey | KYBUJSBSJPVAPV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|