About methyl 4-butoxybenzoate
methyl 4-butoxybenzoate (PubChem CID 4226083) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is methyl 4-butoxybenzoate.
Molecular Properties
| Compound Name | methyl 4-butoxybenzoate |
| PubChem CID | 4226083 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | methyl 4-butoxybenzoate |
| SMILES | CCCCOc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C12H16O3/c1-3-4-9-15-11-7-5-10(6-8-11)12(13)14-2/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | PUHCYTHGLBCWEA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-butoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-butoxybenzoate?
The IUPAC name of methyl 4-butoxybenzoate (CID 4226083) is methyl 4-butoxybenzoate.
What is the SMILES notation for methyl 4-butoxybenzoate?
The canonical SMILES for methyl 4-butoxybenzoate is CCCCOc1ccc(C(=O)OC)cc1.
What is the InChIKey of methyl 4-butoxybenzoate?
The InChIKey is PUHCYTHGLBCWEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-3-4-9-15-11-7-5-10(6-8-11)12(13)14-2/h5-8H,3-4,9H2,1-2H3.
What are the key properties of methyl 4-butoxybenzoate?
methyl 4-butoxybenzoate has a molecular weight of 208.26 g/mol, XLogP of 2.65, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-butoxybenzoate is sourced from PubChem (CID 4226083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).